About 1,2-diiodocyclobutane
1,2-diiodocyclobutane (PubChem CID 23554281) has the molecular formula C4H6I2
and a molecular weight of 307.90 g/mol. Its IUPAC name is 1,2-diiodocyclobutane.
Molecular Properties
| Compound Name | 1,2-diiodocyclobutane |
| PubChem CID | 23554281 |
| Molecular Formula | C4H6I2 |
| Molecular Weight | 307.90 g/mol |
| Exact Mass | 307.86 |
| IUPAC Name | 1,2-diiodocyclobutane |
| SMILES | IC1CCC1I |
| InChI | InChI=1S/C4H6I2/c5-3-1-2-4(3)6/h3-4H,1-2H2 |
| InChIKey | YCRHYFBSNZTSAJ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.90 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1,2-diiodocyclobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-diiodocyclobutane?
The IUPAC name of 1,2-diiodocyclobutane (CID 23554281) is 1,2-diiodocyclobutane.
What is the SMILES notation for 1,2-diiodocyclobutane?
The canonical SMILES for 1,2-diiodocyclobutane is IC1CCC1I.
What is the InChIKey of 1,2-diiodocyclobutane?
The InChIKey is YCRHYFBSNZTSAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6I2/c5-3-1-2-4(3)6/h3-4H,1-2H2.
What are the key properties of 1,2-diiodocyclobutane?
1,2-diiodocyclobutane has a molecular weight of 307.90 g/mol, XLogP of 2.39, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-diiodocyclobutane is sourced from PubChem (CID 23554281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).