C11H15N3O3 — CID 23554583
8-(methylamino)-6-(oxiran-2-ylmethyl)-5,8-dihydro-4H-[1,3]oxazolo[4,5-d]azepin-7-one (PubChem CID 23554583) has the molecular formula C11H15N3O3 and a molecular weight of 237.26 g/mol. Its IUPAC name is 8-(methylamino)-6-(oxiran-2-ylmethyl)-5,8-dihydro-4H-[1,3]oxazolo[4,5-d]azepin-7-one.
| Compound Name | 8-(methylamino)-6-(oxiran-2-ylmethyl)-5,8-dihydro-4H-[1,3]oxazolo[4,5-d]azepin-7-one |
|---|---|
| PubChem CID | 23554583 |
| Molecular Formula | C11H15N3O3 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | 8-(methylamino)-6-(oxiran-2-ylmethyl)-5,8-dihydro-4H-[1,3]oxazolo[4,5-d]azepin-7-one |
| SMILES | CNC1C(=O)N(CC2CO2)CCc2ncoc21 |
| InChI | InChI=1S/C11H15N3O3/c1-12-9-10-8(13-6-17-10)2-3-14(11(9)15)4-7-5-16-7/h6-7,9,12H,2-5H2,1H3 |
| InChIKey | RHJFTCDNCLVWAR-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 70.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|