C15H21N3O2 — CID 23554721
6-cyclohept-2-en-1-yl-8-(methylamino)-5,8-dihydro-4H-[1,3]oxazolo[4,5-d]azepin-7-one (PubChem CID 23554721) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is 6-cyclohept-2-en-1-yl-8-(methylamino)-5,8-dihydro-4H-[1,3]oxazolo[4,5-d]azepin-7-one.
| Compound Name | 6-cyclohept-2-en-1-yl-8-(methylamino)-5,8-dihydro-4H-[1,3]oxazolo[4,5-d]azepin-7-one |
|---|---|
| PubChem CID | 23554721 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 6-cyclohept-2-en-1-yl-8-(methylamino)-5,8-dihydro-4H-[1,3]oxazolo[4,5-d]azepin-7-one |
| SMILES | CNC1C(=O)N(C2C=CCCCC2)CCc2ncoc21 |
| InChI | InChI=1S/C15H21N3O2/c1-16-13-14-12(17-10-20-14)8-9-18(15(13)19)11-6-4-2-3-5-7-11/h4,6,10-11,13,16H,2-3,5,7-9H2,1H3 |
| InChIKey | NWFVDAKOWKRYLE-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|