About 1,3-ditert-butyl-3H-1,4-benzodiazepin-2-one
1,3-ditert-butyl-3H-1,4-benzodiazepin-2-one (PubChem CID 23555163) has the molecular formula C17H24N2O
and a molecular weight of 272.39 g/mol. Its IUPAC name is 1,3-ditert-butyl-3H-1,4-benzodiazepin-2-one.
Molecular Properties
| Compound Name | 1,3-ditert-butyl-3H-1,4-benzodiazepin-2-one |
| PubChem CID | 23555163 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | 1,3-ditert-butyl-3H-1,4-benzodiazepin-2-one |
| SMILES | CC(C)(C)C1N=Cc2ccccc2N(C(C)(C)C)C1=O |
| InChI | InChI=1S/C17H24N2O/c1-16(2,3)14-15(20)19(17(4,5)6)13-10-8-7-9-12(13)11-18-14/h7-11,14H,1-6H3 |
| InChIKey | WFXSLJCWWPUAHU-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,3-ditert-butyl-3H-1,4-benzodiazepin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-ditert-butyl-3H-1,4-benzodiazepin-2-one?
The IUPAC name of 1,3-ditert-butyl-3H-1,4-benzodiazepin-2-one (CID 23555163) is 1,3-ditert-butyl-3H-1,4-benzodiazepin-2-one.
What is the SMILES notation for 1,3-ditert-butyl-3H-1,4-benzodiazepin-2-one?
The canonical SMILES for 1,3-ditert-butyl-3H-1,4-benzodiazepin-2-one is CC(C)(C)C1N=Cc2ccccc2N(C(C)(C)C)C1=O.
What is the InChIKey of 1,3-ditert-butyl-3H-1,4-benzodiazepin-2-one?
The InChIKey is WFXSLJCWWPUAHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N2O/c1-16(2,3)14-15(20)19(17(4,5)6)13-10-8-7-9-12(13)11-18-14/h7-11,14H,1-6H3.
What are the key properties of 1,3-ditert-butyl-3H-1,4-benzodiazepin-2-one?
1,3-ditert-butyl-3H-1,4-benzodiazepin-2-one has a molecular weight of 272.39 g/mol, XLogP of 3.67, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-ditert-butyl-3H-1,4-benzodiazepin-2-one is sourced from PubChem (CID 23555163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).