C18H26N2O2 — CID 23555173
3,5-ditert-butyl-1-methyl-1,5-benzodiazepine-2,4-dione (PubChem CID 23555173) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is 3,5-ditert-butyl-1-methyl-1,5-benzodiazepine-2,4-dione.
| Compound Name | 3,5-ditert-butyl-1-methyl-1,5-benzodiazepine-2,4-dione |
|---|---|
| PubChem CID | 23555173 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | 3,5-ditert-butyl-1-methyl-1,5-benzodiazepine-2,4-dione |
| SMILES | CN1C(=O)C(C(C)(C)C)C(=O)N(C(C)(C)C)c2ccccc21 |
| InChI | InChI=1S/C18H26N2O2/c1-17(2,3)14-15(21)19(7)12-10-8-9-11-13(12)20(16(14)22)18(4,5)6/h8-11,14H,1-7H3 |
| InChIKey | OHILRWLPGRSLLX-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|