C24H33N5O3 — CID 23555259
2-[4-[5-[(2R,6S)-2,6-dimethylpiperidin-1-yl]pentyl]-3-oxo-1,4-benzoxazin-2-yl]-1,3-oxazole-5-carboximidamide (PubChem CID 23555259) has the molecular formula C24H33N5O3 and a molecular weight of 439.56 g/mol. Its IUPAC name is 2-[4-[5-[(2R,6S)-2,6-dimethylpiperidin-1-yl]pentyl]-3-oxo-1,4-benzoxazin-2-yl]-1,3-oxazole-5-carboximidamide.
| Compound Name | 2-[4-[5-[(2R,6S)-2,6-dimethylpiperidin-1-yl]pentyl]-3-oxo-1,4-benzoxazin-2-yl]-1,3-oxazole-5-carboximidamide |
|---|---|
| PubChem CID | 23555259 |
| Molecular Formula | C24H33N5O3 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.26 |
| IUPAC Name | 2-[4-[5-[(2R,6S)-2,6-dimethylpiperidin-1-yl]pentyl]-3-oxo-1,4-benzoxazin-2-yl]-1,3-oxazole-5-carboximidamide |
| SMILES | [H]/N=C(\N)c1cnc(C2Oc3ccccc3N(CCCCCN3[C@H](C)CCC[C@@H]3C)C2=O)o1 |
| InChI | InChI=1S/C24H33N5O3/c1-16-9-8-10-17(2)28(16)13-6-3-7-14-29-18-11-4-5-12-19(18)31-21(24(29)30)23-27-15-20(32-23)22(25)26/h4-5,11-12,15-17,21H,3,6-10,13-14H2,1-2H3,(H3,25,26)/t16-,17+,21? |
| InChIKey | PXHZHVVCIVIYEL-QRTHJKPMSA-N |
| XLogP | 3.86 |
| TPSA | 108.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|