C26H41N3OS — CID 23555366
2-[(3-aminocyclopentyl)methyl]-4-[5-[(2R,6S)-2,6-dimethylpiperidin-1-yl]pentyl]-1,4-benzothiazin-3-one (PubChem CID 23555366) has the molecular formula C26H41N3OS and a molecular weight of 443.70 g/mol. Its IUPAC name is 2-[(3-aminocyclopentyl)methyl]-4-[5-[(2R,6S)-2,6-dimethylpiperidin-1-yl]pentyl]-1,4-benzothiazin-3-one.
| Compound Name | 2-[(3-aminocyclopentyl)methyl]-4-[5-[(2R,6S)-2,6-dimethylpiperidin-1-yl]pentyl]-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 23555366 |
| Molecular Formula | C26H41N3OS |
| Molecular Weight | 443.70 g/mol |
| Exact Mass | 443.30 |
| IUPAC Name | 2-[(3-aminocyclopentyl)methyl]-4-[5-[(2R,6S)-2,6-dimethylpiperidin-1-yl]pentyl]-1,4-benzothiazin-3-one |
| SMILES | C[C@@H]1CCC[C@H](C)N1CCCCCN1C(=O)C(CC2CCC(N)C2)Sc2ccccc21 |
| InChI | InChI=1S/C26H41N3OS/c1-19-9-8-10-20(2)28(19)15-6-3-7-16-29-23-11-4-5-12-24(23)31-25(26(29)30)18-21-13-14-22(27)17-21/h4-5,11-12,19-22,25H,3,6-10,13-18,27H2,1-2H3/t19-,20+,21?,22?,25? |
| InChIKey | LQJWGJRJZKYBSY-FFDMGAJQSA-N |
| XLogP | 5.44 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.70 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|