C26H35N5OS — CID 23555394
3-[4-[2-[2-[(2S,6R)-2,6-dimethylpiperidin-1-yl]ethylamino]ethyl]-3-oxo-1,4-benzothiazin-2-yl]benzenecarboximidamide (PubChem CID 23555394) has the molecular formula C26H35N5OS and a molecular weight of 465.67 g/mol. Its IUPAC name is 3-[4-[2-[2-[(2S,6R)-2,6-dimethylpiperidin-1-yl]ethylamino]ethyl]-3-oxo-1,4-benzothiazin-2-yl]benzenecarboximidamide.
| Compound Name | 3-[4-[2-[2-[(2S,6R)-2,6-dimethylpiperidin-1-yl]ethylamino]ethyl]-3-oxo-1,4-benzothiazin-2-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 23555394 |
| Molecular Formula | C26H35N5OS |
| Molecular Weight | 465.67 g/mol |
| Exact Mass | 465.26 |
| IUPAC Name | 3-[4-[2-[2-[(2S,6R)-2,6-dimethylpiperidin-1-yl]ethylamino]ethyl]-3-oxo-1,4-benzothiazin-2-yl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(C2Sc3ccccc3N(CCNCCN3[C@H](C)CCC[C@@H]3C)C2=O)c1 |
| InChI | InChI=1S/C26H35N5OS/c1-18-7-5-8-19(2)30(18)15-13-29-14-16-31-22-11-3-4-12-23(22)33-24(26(31)32)20-9-6-10-21(17-20)25(27)28/h3-4,6,9-12,17-19,24,29H,5,7-8,13-16H2,1-2H3,(H3,27,28)/t18-,19+,24? |
| InChIKey | OODQRKGTUSRXJR-QRQCMCJISA-N |
| XLogP | 4.00 |
| TPSA | 85.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.67 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|