C45H30N10O10 — CID 23555825
1-[3-[3,5-bis(3-isocyanato-4-methylphenyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]-4-methylphenyl]-3,5-bis(3-isocyanato-4-methylphenyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 23555825) has the molecular formula C45H30N10O10 and a molecular weight of 870.79 g/mol. Its IUPAC name is 1-[3-[3,5-bis(3-isocyanato-4-methylphenyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]-4-methylphenyl]-3,5-bis(3-isocyanato-4-methylphenyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-[3-[3,5-bis(3-isocyanato-4-methylphenyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]-4-methylphenyl]-3,5-bis(3-isocyanato-4-methylphenyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 23555825 |
| Molecular Formula | C45H30N10O10 |
| Molecular Weight | 870.79 g/mol |
| Exact Mass | 870.21 |
| IUPAC Name | 1-[3-[3,5-bis(3-isocyanato-4-methylphenyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]-4-methylphenyl]-3,5-bis(3-isocyanato-4-methylphenyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | Cc1ccc(-n2c(=O)n(-c3ccc(C)c(N=C=O)c3)c(=O)n(-c3ccc(C)c(-n4c(=O)n(-c5ccc(C)c(N=C=O)c5)c(=O)n(-c5ccc(C)c(N=C=O)c5)c4=O)c3)c2=O)cc1N=C=O |
| InChI | InChI=1S/C45H30N10O10/c1-25-6-11-30(16-35(25)46-21-56)50-40(60)51(31-12-7-26(2)36(17-31)47-22-57)42(62)54(41(50)61)34-15-10-29(5)39(20-34)55-44(64)52(32-13-8-27(3)37(18-32)48-23-58)43(63)53(45(55)65)33-14-9-28(4)38(19-33)49-24-59/h6-20H,1-5H3 |
| InChIKey | OWTPSGDYDAITPE-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 249.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 870.79 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|