About 1-methoxy-2-propa-1,2-dienoxypropane
1-methoxy-2-propa-1,2-dienoxypropane (PubChem CID 23555847) has the molecular formula C7H12O2
and a molecular weight of 128.17 g/mol. Its IUPAC name is 1-methoxy-2-propa-1,2-dienoxypropane.
Molecular Properties
| Compound Name | 1-methoxy-2-propa-1,2-dienoxypropane |
| PubChem CID | 23555847 |
| Molecular Formula | C7H12O2 |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.08 |
| IUPAC Name | 1-methoxy-2-propa-1,2-dienoxypropane |
| SMILES | C=C=COC(C)COC |
| InChI | InChI=1S/C7H12O2/c1-4-5-9-7(2)6-8-3/h5,7H,1,6H2,2-3H3 |
| InChIKey | AWYCBXLPWYIYIC-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxy-2-propa-1,2-dienoxypropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-2-propa-1,2-dienoxypropane?
The IUPAC name of 1-methoxy-2-propa-1,2-dienoxypropane (CID 23555847) is 1-methoxy-2-propa-1,2-dienoxypropane.
What is the SMILES notation for 1-methoxy-2-propa-1,2-dienoxypropane?
The canonical SMILES for 1-methoxy-2-propa-1,2-dienoxypropane is C=C=COC(C)COC.
What is the InChIKey of 1-methoxy-2-propa-1,2-dienoxypropane?
The InChIKey is AWYCBXLPWYIYIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O2/c1-4-5-9-7(2)6-8-3/h5,7H,1,6H2,2-3H3.
What are the key properties of 1-methoxy-2-propa-1,2-dienoxypropane?
1-methoxy-2-propa-1,2-dienoxypropane has a molecular weight of 128.17 g/mol, XLogP of 1.34, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-2-propa-1,2-dienoxypropane is sourced from PubChem (CID 23555847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).