C16H17BN4O3 — CID 23556691
3-(oxoboranylmethylideneamino)-1-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]azepan-2-one (PubChem CID 23556691) has the molecular formula C16H17BN4O3 and a molecular weight of 324.15 g/mol. Its IUPAC name is 3-(oxoboranylmethylideneamino)-1-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]azepan-2-one.
| Compound Name | 3-(oxoboranylmethylideneamino)-1-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]azepan-2-one |
|---|---|
| PubChem CID | 23556691 |
| Molecular Formula | C16H17BN4O3 |
| Molecular Weight | 324.15 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 3-(oxoboranylmethylideneamino)-1-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]azepan-2-one |
| SMILES | O=B/C=N/C1CCCCN(Cc2nc(-c3ccccc3)no2)C1=O |
| InChI | InChI=1S/C16H17BN4O3/c22-16-13(18-11-17-23)8-4-5-9-21(16)10-14-19-15(20-24-14)12-6-2-1-3-7-12/h1-3,6-7,11,13H,4-5,8-10H2/b18-11+ |
| InChIKey | CERDHKBDAKSTQI-WOJGMQOQSA-N |
| XLogP | 1.70 |
| TPSA | 88.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.15 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|