C34H22F6N2O8S2 — CID 23557624
bis[(Z)-[2,2,2-trifluoro-1-(4-phenoxyphenyl)ethylidene]amino] benzene-1,3-disulfonate (PubChem CID 23557624) has the molecular formula C34H22F6N2O8S2 and a molecular weight of 764.68 g/mol. Its IUPAC name is bis[(Z)-[2,2,2-trifluoro-1-(4-phenoxyphenyl)ethylidene]amino] benzene-1,3-disulfonate.
| Compound Name | bis[(Z)-[2,2,2-trifluoro-1-(4-phenoxyphenyl)ethylidene]amino] benzene-1,3-disulfonate |
|---|---|
| PubChem CID | 23557624 |
| Molecular Formula | C34H22F6N2O8S2 |
| Molecular Weight | 764.68 g/mol |
| Exact Mass | 764.07 |
| IUPAC Name | bis[(Z)-[2,2,2-trifluoro-1-(4-phenoxyphenyl)ethylidene]amino] benzene-1,3-disulfonate |
| SMILES | O=S(=O)(O/N=C(/c1ccc(Oc2ccccc2)cc1)C(F)(F)F)c1cccc(S(=O)(=O)O/N=C(/c2ccc(Oc3ccccc3)cc2)C(F)(F)F)c1 |
| InChI | InChI=1S/C34H22F6N2O8S2/c35-33(36,37)31(23-14-18-27(19-15-23)47-25-8-3-1-4-9-25)41-49-51(43,44)29-12-7-13-30(22-29)52(45,46)50-42-32(34(38,39)40)24-16-20-28(21-17-24)48-26-10-5-2-6-11-26/h1-22H/b41-31-,42-32- |
| InChIKey | YELLCUWCZLZNCJ-CMRZERMZSA-N |
| XLogP | 8.61 |
| TPSA | 129.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.68 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|