C8H6F12O — CID 23557659
2-[difluoro(1,1,2-trifluoroethoxy)methyl]-1,1,1,4,5,5,5-heptafluoropentane (PubChem CID 23557659) has the molecular formula C8H6F12O and a molecular weight of 346.11 g/mol. Its IUPAC name is 2-[difluoro(1,1,2-trifluoroethoxy)methyl]-1,1,1,4,5,5,5-heptafluoropentane.
| Compound Name | 2-[difluoro(1,1,2-trifluoroethoxy)methyl]-1,1,1,4,5,5,5-heptafluoropentane |
|---|---|
| PubChem CID | 23557659 |
| Molecular Formula | C8H6F12O |
| Molecular Weight | 346.11 g/mol |
| Exact Mass | 346.02 |
| IUPAC Name | 2-[difluoro(1,1,2-trifluoroethoxy)methyl]-1,1,1,4,5,5,5-heptafluoropentane |
| SMILES | FCC(F)(F)OC(F)(F)C(CC(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H6F12O/c9-2-5(11,12)21-8(19,20)3(6(13,14)15)1-4(10)7(16,17)18/h3-4H,1-2H2 |
| InChIKey | IABGBYOIYRUCDU-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.11 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |