C12H16N6O4 — CID 23557819
2-[2-(2,5-dioxopyrrol-1-yl)ethyl-[2-(2-methylidenehydrazinyl)-2-oxoethyl]amino]-N-(methylideneamino)acetamide (PubChem CID 23557819) has the molecular formula C12H16N6O4 and a molecular weight of 308.30 g/mol. Its IUPAC name is 2-[2-(2,5-dioxopyrrol-1-yl)ethyl-[2-(2-methylidenehydrazinyl)-2-oxoethyl]amino]-N-(methylideneamino)acetamide.
| Compound Name | 2-[2-(2,5-dioxopyrrol-1-yl)ethyl-[2-(2-methylidenehydrazinyl)-2-oxoethyl]amino]-N-(methylideneamino)acetamide |
|---|---|
| PubChem CID | 23557819 |
| Molecular Formula | C12H16N6O4 |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 2-[2-(2,5-dioxopyrrol-1-yl)ethyl-[2-(2-methylidenehydrazinyl)-2-oxoethyl]amino]-N-(methylideneamino)acetamide |
| SMILES | C=NNC(=O)CN(CCN1C(=O)C=CC1=O)CC(=O)NN=C |
| InChI | InChI=1S/C12H16N6O4/c1-13-15-9(19)7-17(8-10(20)16-14-2)5-6-18-11(21)3-4-12(18)22/h3-4H,1-2,5-8H2,(H,15,19)(H,16,20) |
| InChIKey | XFUIPUSICSRJOO-UHFFFAOYSA-N |
| XLogP | -2.32 |
| TPSA | 123.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | -2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|