C18H34N12O6 — CID 23557820
2-[2-[2-[bis(2-hydrazinyl-2-oxoethyl)amino]ethyl-[2-(2,5-dioxopyrrol-1-yl)ethyl]amino]ethyl-(2-hydrazinyl-2-oxoethyl)amino]acetohydrazide (PubChem CID 23557820) has the molecular formula C18H34N12O6 and a molecular weight of 514.55 g/mol. Its IUPAC name is 2-[2-[2-[bis(2-hydrazinyl-2-oxoethyl)amino]ethyl-[2-(2,5-dioxopyrrol-1-yl)ethyl]amino]ethyl-(2-hydrazinyl-2-oxoethyl)amino]acetohydrazide.
| Compound Name | 2-[2-[2-[bis(2-hydrazinyl-2-oxoethyl)amino]ethyl-[2-(2,5-dioxopyrrol-1-yl)ethyl]amino]ethyl-(2-hydrazinyl-2-oxoethyl)amino]acetohydrazide |
|---|---|
| PubChem CID | 23557820 |
| Molecular Formula | C18H34N12O6 |
| Molecular Weight | 514.55 g/mol |
| Exact Mass | 514.27 |
| IUPAC Name | 2-[2-[2-[bis(2-hydrazinyl-2-oxoethyl)amino]ethyl-[2-(2,5-dioxopyrrol-1-yl)ethyl]amino]ethyl-(2-hydrazinyl-2-oxoethyl)amino]acetohydrazide |
| SMILES | NNC(=O)CN(CCN(CCN(CC(=O)NN)CC(=O)NN)CCN1C(=O)C=CC1=O)CC(=O)NN |
| InChI | InChI=1S/C18H34N12O6/c19-23-13(31)9-28(10-14(32)24-20)5-3-27(7-8-30-17(35)1-2-18(30)36)4-6-29(11-15(33)25-21)12-16(34)26-22/h1-2H,3-12,19-22H2,(H,23,31)(H,24,32)(H,25,33)(H,26,34) |
| InChIKey | JSDXIRJEBBYWTO-UHFFFAOYSA-N |
| XLogP | -7.22 |
| TPSA | 267.58 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.55 |
| LogP ≤ 5 | -7.22 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|