C11H16N6O5 — CID 23557834
N-(1,5-dihydrazinyl-1,5-dioxopentan-2-yl)-2-(2,5-dioxopyrrol-1-yl)acetamide (PubChem CID 23557834) has the molecular formula C11H16N6O5 and a molecular weight of 312.29 g/mol. Its IUPAC name is N-(1,5-dihydrazinyl-1,5-dioxopentan-2-yl)-2-(2,5-dioxopyrrol-1-yl)acetamide.
| Compound Name | N-(1,5-dihydrazinyl-1,5-dioxopentan-2-yl)-2-(2,5-dioxopyrrol-1-yl)acetamide |
|---|---|
| PubChem CID | 23557834 |
| Molecular Formula | C11H16N6O5 |
| Molecular Weight | 312.29 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | N-(1,5-dihydrazinyl-1,5-dioxopentan-2-yl)-2-(2,5-dioxopyrrol-1-yl)acetamide |
| SMILES | NNC(=O)CCC(NC(=O)CN1C(=O)C=CC1=O)C(=O)NN |
| InChI | InChI=1S/C11H16N6O5/c12-15-7(18)2-1-6(11(22)16-13)14-8(19)5-17-9(20)3-4-10(17)21/h3-4,6H,1-2,5,12-13H2,(H,14,19)(H,15,18)(H,16,22) |
| InChIKey | OLTKJCYZMNCUHZ-UHFFFAOYSA-N |
| XLogP | -3.84 |
| TPSA | 176.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.29 |
| LogP ≤ 5 | -3.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|