About 2-ethyl-4-fluoro-3,5-dimethyloxolane
2-ethyl-4-fluoro-3,5-dimethyloxolane (PubChem CID 23557851) has the molecular formula C8H15FO
and a molecular weight of 146.20 g/mol. Its IUPAC name is 2-ethyl-4-fluoro-3,5-dimethyloxolane.
Molecular Properties
| Compound Name | 2-ethyl-4-fluoro-3,5-dimethyloxolane |
| PubChem CID | 23557851 |
| Molecular Formula | C8H15FO |
| Molecular Weight | 146.20 g/mol |
| Exact Mass | 146.11 |
| IUPAC Name | 2-ethyl-4-fluoro-3,5-dimethyloxolane |
| SMILES | CCC1OC(C)C(F)C1C |
| InChI | InChI=1S/C8H15FO/c1-4-7-5(2)8(9)6(3)10-7/h5-8H,4H2,1-3H3 |
| InChIKey | NMVDVHVCRNZBSS-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.20 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-ethyl-4-fluoro-3,5-dimethyloxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-4-fluoro-3,5-dimethyloxolane?
The IUPAC name of 2-ethyl-4-fluoro-3,5-dimethyloxolane (CID 23557851) is 2-ethyl-4-fluoro-3,5-dimethyloxolane.
What is the SMILES notation for 2-ethyl-4-fluoro-3,5-dimethyloxolane?
The canonical SMILES for 2-ethyl-4-fluoro-3,5-dimethyloxolane is CCC1OC(C)C(F)C1C.
What is the InChIKey of 2-ethyl-4-fluoro-3,5-dimethyloxolane?
The InChIKey is NMVDVHVCRNZBSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15FO/c1-4-7-5(2)8(9)6(3)10-7/h5-8H,4H2,1-3H3.
What are the key properties of 2-ethyl-4-fluoro-3,5-dimethyloxolane?
2-ethyl-4-fluoro-3,5-dimethyloxolane has a molecular weight of 146.20 g/mol, XLogP of 2.16, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-4-fluoro-3,5-dimethyloxolane is sourced from PubChem (CID 23557851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).