C13H13NS — CID 23557929
3,4-dimethyl-6-thia-2-azatricyclo[7.3.1.05,13]trideca-1(12),2,4,9(13),10-pentaene (PubChem CID 23557929) has the molecular formula C13H13NS and a molecular weight of 215.32 g/mol. Its IUPAC name is 3,4-dimethyl-6-thia-2-azatricyclo[7.3.1.05,13]trideca-1(12),2,4,9(13),10-pentaene.
| Compound Name | 3,4-dimethyl-6-thia-2-azatricyclo[7.3.1.05,13]trideca-1(12),2,4,9(13),10-pentaene |
|---|---|
| PubChem CID | 23557929 |
| Molecular Formula | C13H13NS |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | 3,4-dimethyl-6-thia-2-azatricyclo[7.3.1.05,13]trideca-1(12),2,4,9(13),10-pentaene |
| SMILES | Cc1nc2cccc3c2c(c1C)SCC3 |
| InChI | InChI=1S/C13H13NS/c1-8-9(2)14-11-5-3-4-10-6-7-15-13(8)12(10)11/h3-5H,6-7H2,1-2H3 |
| InChIKey | UWRPOECQAGDWRB-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |