C16H22F6O6 — CID 23557981
2-[2-(3,3,4,4,5,5-hexafluoropentoxycarbonyl)butyl]-4-methylpentanedioic acid (PubChem CID 23557981) has the molecular formula C16H22F6O6 and a molecular weight of 424.33 g/mol. Its IUPAC name is 2-[2-(3,3,4,4,5,5-hexafluoropentoxycarbonyl)butyl]-4-methylpentanedioic acid.
| Compound Name | 2-[2-(3,3,4,4,5,5-hexafluoropentoxycarbonyl)butyl]-4-methylpentanedioic acid |
|---|---|
| PubChem CID | 23557981 |
| Molecular Formula | C16H22F6O6 |
| Molecular Weight | 424.33 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | 2-[2-(3,3,4,4,5,5-hexafluoropentoxycarbonyl)butyl]-4-methylpentanedioic acid |
| SMILES | CCC(CC(CC(C)C(=O)O)C(=O)O)C(=O)OCCC(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C16H22F6O6/c1-3-9(7-10(12(25)26)6-8(2)11(23)24)13(27)28-5-4-15(19,20)16(21,22)14(17)18/h8-10,14H,3-7H2,1-2H3,(H,23,24)(H,25,26) |
| InChIKey | KCYLGDSNZMEBQF-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.33 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|