About didecyl(dimethyl)azanium chloride
didecyl(dimethyl)azanium chloride (PubChem CID 23558) has the molecular formula C22H48ClN
and a molecular weight of 362.09 g/mol. Its IUPAC name is didecyl(dimethyl)azanium chloride.
Molecular Properties
| Compound Name | didecyl(dimethyl)azanium chloride |
| PubChem CID | 23558 |
| Molecular Formula | C22H48ClN |
| Molecular Weight | 362.09 g/mol |
| Exact Mass | 361.35 |
| IUPAC Name | didecyl(dimethyl)azanium chloride |
| SMILES | CCCCCCCCCC[N+](C)(C)CCCCCCCCCC.[Cl-] |
| InChI | InChI=1S/C22H48N.ClH/c1-5-7-9-11-13-15-17-19-21-23(3,4)22-20-18-16-14-12-10-8-6-2;/h5-22H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | RUPBZQFQVRMKDG-UHFFFAOYSA-M |
| XLogP | 4.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 18 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.09 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze didecyl(dimethyl)azanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of didecyl(dimethyl)azanium chloride?
The IUPAC name of didecyl(dimethyl)azanium chloride (CID 23558) is didecyl(dimethyl)azanium chloride.
What is the SMILES notation for didecyl(dimethyl)azanium chloride?
The canonical SMILES for didecyl(dimethyl)azanium chloride is CCCCCCCCCC[N+](C)(C)CCCCCCCCCC.[Cl-].
What is the InChIKey of didecyl(dimethyl)azanium chloride?
The InChIKey is RUPBZQFQVRMKDG-UHFFFAOYSA-M. The full InChI is InChI=1S/C22H48N.ClH/c1-5-7-9-11-13-15-17-19-21-23(3,4)22-20-18-16-14-12-10-8-6-2;/h5-22H2,1-4H3;1H/q+1;/p-1.
What are the key properties of didecyl(dimethyl)azanium chloride?
didecyl(dimethyl)azanium chloride has a molecular weight of 362.09 g/mol, XLogP of 4.35, 18 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for didecyl(dimethyl)azanium chloride is sourced from PubChem (CID 23558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).