About 2-amino-6-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]hexanamide
2-amino-6-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]hexanamide (PubChem CID 23558128) has the molecular formula C13H20N4O4
and a molecular weight of 296.33 g/mol. Its IUPAC name is 2-amino-6-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]hexanamide.
Molecular Properties
| Compound Name | 2-amino-6-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]hexanamide |
| PubChem CID | 23558128 |
| Molecular Formula | C13H20N4O4 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 2-amino-6-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]hexanamide |
| SMILES | NC(=O)C(N)CCCCNC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C13H20N4O4/c14-9(13(15)21)3-1-2-7-16-10(18)6-8-17-11(19)4-5-12(17)20/h4-5,9H,1-3,6-8,14H2,(H2,15,21)(H,16,18) |
| InChIKey | FDTVCGJTJZYXDV-UHFFFAOYSA-N |
| XLogP | -1.60 |
| TPSA | 135.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-6-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]hexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-6-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]hexanamide?
The IUPAC name of 2-amino-6-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]hexanamide (CID 23558128) is 2-amino-6-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]hexanamide.
What is the SMILES notation for 2-amino-6-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]hexanamide?
The canonical SMILES for 2-amino-6-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]hexanamide is NC(=O)C(N)CCCCNC(=O)CCN1C(=O)C=CC1=O.
What is the InChIKey of 2-amino-6-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]hexanamide?
The InChIKey is FDTVCGJTJZYXDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N4O4/c14-9(13(15)21)3-1-2-7-16-10(18)6-8-17-11(19)4-5-12(17)20/h4-5,9H,1-3,6-8,14H2,(H2,15,21)(H,16,18).
What are the key properties of 2-amino-6-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]hexanamide?
2-amino-6-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]hexanamide has a molecular weight of 296.33 g/mol, XLogP of -1.60, 9 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-6-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]hexanamide is sourced from PubChem (CID 23558128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).