C6H8N4O2 — CID 23558449
1-methyl-3,4,5,7-tetrahydropurine-2,6-dione (PubChem CID 23558449) has the molecular formula C6H8N4O2 and a molecular weight of 168.16 g/mol. Its IUPAC name is 1-methyl-3,4,5,7-tetrahydropurine-2,6-dione.
| Compound Name | 1-methyl-3,4,5,7-tetrahydropurine-2,6-dione |
|---|---|
| PubChem CID | 23558449 |
| Molecular Formula | C6H8N4O2 |
| Molecular Weight | 168.16 g/mol |
| Exact Mass | 168.06 |
| IUPAC Name | 1-methyl-3,4,5,7-tetrahydropurine-2,6-dione |
| SMILES | CN1C(=O)NC2N=CNC2C1=O |
| InChI | InChI=1S/C6H8N4O2/c1-10-5(11)3-4(8-2-7-3)9-6(10)12/h2-4H,1H3,(H,7,8)(H,9,12) |
| InChIKey | IJAIBUNBCXCQQQ-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.16 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |