About 2-bromo-2-methoxyethanol
2-bromo-2-methoxyethanol (PubChem CID 23558670) has the molecular formula C3H7BrO2
and a molecular weight of 154.99 g/mol. Its IUPAC name is 2-bromo-2-methoxyethanol.
Molecular Properties
| Compound Name | 2-bromo-2-methoxyethanol |
| PubChem CID | 23558670 |
| Molecular Formula | C3H7BrO2 |
| Molecular Weight | 154.99 g/mol |
| Exact Mass | 153.96 |
| IUPAC Name | 2-bromo-2-methoxyethanol |
| SMILES | COC(Br)CO |
| InChI | InChI=1S/C3H7BrO2/c1-6-3(4)2-5/h3,5H,2H2,1H3 |
| InChIKey | GATFIAQRSGLJHR-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.99 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-2-methoxyethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-2-methoxyethanol?
The IUPAC name of 2-bromo-2-methoxyethanol (CID 23558670) is 2-bromo-2-methoxyethanol.
What is the SMILES notation for 2-bromo-2-methoxyethanol?
The canonical SMILES for 2-bromo-2-methoxyethanol is COC(Br)CO.
What is the InChIKey of 2-bromo-2-methoxyethanol?
The InChIKey is GATFIAQRSGLJHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7BrO2/c1-6-3(4)2-5/h3,5H,2H2,1H3.
What are the key properties of 2-bromo-2-methoxyethanol?
2-bromo-2-methoxyethanol has a molecular weight of 154.99 g/mol, XLogP of 0.35, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-2-methoxyethanol is sourced from PubChem (CID 23558670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).