C10H17N — CID 23558737
3-methyl-1,4,4a,5,6,7,8,8a-octahydroisoquinoline (PubChem CID 23558737) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is 3-methyl-1,4,4a,5,6,7,8,8a-octahydroisoquinoline.
| Compound Name | 3-methyl-1,4,4a,5,6,7,8,8a-octahydroisoquinoline |
|---|---|
| PubChem CID | 23558737 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 3-methyl-1,4,4a,5,6,7,8,8a-octahydroisoquinoline |
| SMILES | CC1=NCC2CCCCC2C1 |
| InChI | InChI=1S/C10H17N/c1-8-6-9-4-2-3-5-10(9)7-11-8/h9-10H,2-7H2,1H3 |
| InChIKey | VBKBNHWSXSBSSE-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |