C11H8N6OS — CID 23558967
2-diazenyl-3-imino-8-methylsulfanylindeno[2,3-e][1,2,4]triazin-5-one (PubChem CID 23558967) has the molecular formula C11H8N6OS and a molecular weight of 272.29 g/mol. Its IUPAC name is 2-diazenyl-3-imino-8-methylsulfanylindeno[2,3-e][1,2,4]triazin-5-one.
| Compound Name | 2-diazenyl-3-imino-8-methylsulfanylindeno[2,3-e][1,2,4]triazin-5-one |
|---|---|
| PubChem CID | 23558967 |
| Molecular Formula | C11H8N6OS |
| Molecular Weight | 272.29 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | 2-diazenyl-3-imino-8-methylsulfanylindeno[2,3-e][1,2,4]triazin-5-one |
| SMILES | [H]/N=N/n1nc2c(n/c1=N\[H])C(=O)c1ccc(SC)cc1-2 |
| InChI | InChI=1S/C11H8N6OS/c1-19-5-2-3-6-7(4-5)8-9(10(6)18)14-11(12)17(15-8)16-13/h2-4,12-13H,1H3/b12-11+,16-13+ |
| InChIKey | JXXIWBUGXJDCDT-VUWKKMCJSA-N |
| XLogP | 1.48 |
| TPSA | 107.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.29 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|