C30H40N6O3 — CID 23559065
2-[5-[4-[(R)-[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]phenyl]tetrazol-2-yl]heptanoic acid (PubChem CID 23559065) has the molecular formula C30H40N6O3 and a molecular weight of 532.69 g/mol. Its IUPAC name is 2-[5-[4-[(R)-[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]phenyl]tetrazol-2-yl]heptanoic acid.
| Compound Name | 2-[5-[4-[(R)-[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]phenyl]tetrazol-2-yl]heptanoic acid |
|---|---|
| PubChem CID | 23559065 |
| Molecular Formula | C30H40N6O3 |
| Molecular Weight | 532.69 g/mol |
| Exact Mass | 532.32 |
| IUPAC Name | 2-[5-[4-[(R)-[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]phenyl]tetrazol-2-yl]heptanoic acid |
| SMILES | C=CCN1C[C@H](C)N([C@H](c2ccc(-c3nnn(C(CCCCC)C(=O)O)n3)cc2)c2cccc(O)c2)C[C@H]1C |
| InChI | InChI=1S/C30H40N6O3/c1-5-7-8-12-27(30(38)39)36-32-29(31-33-36)24-15-13-23(14-16-24)28(25-10-9-11-26(37)18-25)35-20-21(3)34(17-6-2)19-22(35)4/h6,9-11,13-16,18,21-22,27-28,37H,2,5,7-8,12,17,19-20H2,1,3-4H3,(H,38,39)/t21-,22+,27?,28-/m1/s1 |
| InChIKey | MEAVQAXSKNABIX-DUYMWEPTSA-N |
| XLogP | 4.92 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.69 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|