About 7-chloro-5-methyl-1H-pyrazolo[4,5-d]pyrimidine
7-chloro-5-methyl-1H-pyrazolo[4,5-d]pyrimidine (PubChem CID 23559516) has the molecular formula C6H5ClN4
and a molecular weight of 168.59 g/mol. Its IUPAC name is 7-chloro-5-methyl-1H-pyrazolo[4,5-d]pyrimidine.
Molecular Properties
| Compound Name | 7-chloro-5-methyl-1H-pyrazolo[4,5-d]pyrimidine |
| PubChem CID | 23559516 |
| Molecular Formula | C6H5ClN4 |
| Molecular Weight | 168.59 g/mol |
| Exact Mass | 168.02 |
| IUPAC Name | 7-chloro-5-methyl-1H-pyrazolo[4,5-d]pyrimidine |
| SMILES | Cc1nc(Cl)c2[nH]ncc2n1 |
| InChI | InChI=1S/C6H5ClN4/c1-3-9-4-2-8-11-5(4)6(7)10-3/h2H,1H3,(H,8,11) |
| InChIKey | OZSZTAKPQQPQMF-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.59 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-chloro-5-methyl-1H-pyrazolo[4,5-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-5-methyl-1H-pyrazolo[4,5-d]pyrimidine?
The IUPAC name of 7-chloro-5-methyl-1H-pyrazolo[4,5-d]pyrimidine (CID 23559516) is 7-chloro-5-methyl-1H-pyrazolo[4,5-d]pyrimidine.
What is the SMILES notation for 7-chloro-5-methyl-1H-pyrazolo[4,5-d]pyrimidine?
The canonical SMILES for 7-chloro-5-methyl-1H-pyrazolo[4,5-d]pyrimidine is Cc1nc(Cl)c2[nH]ncc2n1.
What is the InChIKey of 7-chloro-5-methyl-1H-pyrazolo[4,5-d]pyrimidine?
The InChIKey is OZSZTAKPQQPQMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5ClN4/c1-3-9-4-2-8-11-5(4)6(7)10-3/h2H,1H3,(H,8,11).
What are the key properties of 7-chloro-5-methyl-1H-pyrazolo[4,5-d]pyrimidine?
7-chloro-5-methyl-1H-pyrazolo[4,5-d]pyrimidine has a molecular weight of 168.59 g/mol, XLogP of 1.31, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-5-methyl-1H-pyrazolo[4,5-d]pyrimidine is sourced from PubChem (CID 23559516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).