C13H15N3O — CID 23559680
5-methyl-1,2,3,4-tetrahydropyrido[4,3-b]indole-1-carboxamide (PubChem CID 23559680) has the molecular formula C13H15N3O and a molecular weight of 229.28 g/mol. Its IUPAC name is 5-methyl-1,2,3,4-tetrahydropyrido[4,3-b]indole-1-carboxamide.
| Compound Name | 5-methyl-1,2,3,4-tetrahydropyrido[4,3-b]indole-1-carboxamide |
|---|---|
| PubChem CID | 23559680 |
| Molecular Formula | C13H15N3O |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | 5-methyl-1,2,3,4-tetrahydropyrido[4,3-b]indole-1-carboxamide |
| SMILES | Cn1c2c(c3ccccc31)C(C(N)=O)NCC2 |
| InChI | InChI=1S/C13H15N3O/c1-16-9-5-3-2-4-8(9)11-10(16)6-7-15-12(11)13(14)17/h2-5,12,15H,6-7H2,1H3,(H2,14,17) |
| InChIKey | YSFRZPLSLSTLNB-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|