About 3,4-dimethyl-1H-azepine
3,4-dimethyl-1H-azepine (PubChem CID 23559731) has the molecular formula C8H11N
and a molecular weight of 121.18 g/mol. Its IUPAC name is 3,4-dimethyl-1H-azepine.
Molecular Properties
| Compound Name | 3,4-dimethyl-1H-azepine |
| PubChem CID | 23559731 |
| Molecular Formula | C8H11N |
| Molecular Weight | 121.18 g/mol |
| Exact Mass | 121.09 |
| IUPAC Name | 3,4-dimethyl-1H-azepine |
| SMILES | CC1=CC=CNC=C1C |
| InChI | InChI=1S/C8H11N/c1-7-4-3-5-9-6-8(7)2/h3-6,9H,1-2H3 |
| InChIKey | NPGLTCLYHLAYHL-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.18 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,4-dimethyl-1H-azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethyl-1H-azepine?
The IUPAC name of 3,4-dimethyl-1H-azepine (CID 23559731) is 3,4-dimethyl-1H-azepine.
What is the SMILES notation for 3,4-dimethyl-1H-azepine?
The canonical SMILES for 3,4-dimethyl-1H-azepine is CC1=CC=CNC=C1C.
What is the InChIKey of 3,4-dimethyl-1H-azepine?
The InChIKey is NPGLTCLYHLAYHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N/c1-7-4-3-5-9-6-8(7)2/h3-6,9H,1-2H3.
What are the key properties of 3,4-dimethyl-1H-azepine?
3,4-dimethyl-1H-azepine has a molecular weight of 121.18 g/mol, XLogP of 1.95, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethyl-1H-azepine is sourced from PubChem (CID 23559731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).