About 3,4-dimethyloxepine
3,4-dimethyloxepine (PubChem CID 23559732) has the molecular formula C8H10O
and a molecular weight of 122.17 g/mol. Its IUPAC name is 3,4-dimethyloxepine.
Molecular Properties
| Compound Name | 3,4-dimethyloxepine |
| PubChem CID | 23559732 |
| Molecular Formula | C8H10O |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.07 |
| IUPAC Name | 3,4-dimethyloxepine |
| SMILES | CC1=CC=COC=C1C |
| InChI | InChI=1S/C8H10O/c1-7-4-3-5-9-6-8(7)2/h3-6H,1-2H3 |
| InChIKey | ZXUFXQGEAUSUCW-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,4-dimethyloxepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethyloxepine?
The IUPAC name of 3,4-dimethyloxepine (CID 23559732) is 3,4-dimethyloxepine.
What is the SMILES notation for 3,4-dimethyloxepine?
The canonical SMILES for 3,4-dimethyloxepine is CC1=CC=COC=C1C.
What is the InChIKey of 3,4-dimethyloxepine?
The InChIKey is ZXUFXQGEAUSUCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O/c1-7-4-3-5-9-6-8(7)2/h3-6H,1-2H3.
What are the key properties of 3,4-dimethyloxepine?
3,4-dimethyloxepine has a molecular weight of 122.17 g/mol, XLogP of 2.38, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethyloxepine is sourced from PubChem (CID 23559732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).