C25H30N2O4 — CID 23559976
5-[[2,4-dihydroxy-5-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)phenyl]methyl]imidazolidine-2,4-dione (PubChem CID 23559976) has the molecular formula C25H30N2O4 and a molecular weight of 422.53 g/mol. Its IUPAC name is 5-[[2,4-dihydroxy-5-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)phenyl]methyl]imidazolidine-2,4-dione.
| Compound Name | 5-[[2,4-dihydroxy-5-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)phenyl]methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 23559976 |
| Molecular Formula | C25H30N2O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | 5-[[2,4-dihydroxy-5-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)phenyl]methyl]imidazolidine-2,4-dione |
| SMILES | Cc1cc2c(cc1-c1cc(CC3NC(=O)NC3=O)c(O)cc1O)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C25H30N2O4/c1-13-8-17-18(25(4,5)7-6-24(17,2)3)11-15(13)16-9-14(20(28)12-21(16)29)10-19-22(30)27-23(31)26-19/h8-9,11-12,19,28-29H,6-7,10H2,1-5H3,(H2,26,27,30,31) |
| InChIKey | FFLOGAGFSRBDMC-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|