C26H31NO4S — CID 23559981
5-[[2,4-dimethoxy-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 23559981) has the molecular formula C26H31NO4S and a molecular weight of 453.60 g/mol. Its IUPAC name is 5-[[2,4-dimethoxy-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[2,4-dimethoxy-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 23559981 |
| Molecular Formula | C26H31NO4S |
| Molecular Weight | 453.60 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | 5-[[2,4-dimethoxy-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1ccc(CC2SC(=O)NC2=O)c(OC)c1-c1ccc2c(c1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C26H31NO4S/c1-25(2)11-12-26(3,4)18-13-15(7-9-17(18)25)21-19(30-5)10-8-16(22(21)31-6)14-20-23(28)27-24(29)32-20/h7-10,13,20H,11-12,14H2,1-6H3,(H,27,28,29) |
| InChIKey | AZSVXVZJPAEIOX-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.60 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|