C26H31FN2O3 — CID 23560016
5-[[3-fluoro-4-methoxy-5-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)phenyl]methyl]imidazolidine-2,4-dione (PubChem CID 23560016) has the molecular formula C26H31FN2O3 and a molecular weight of 438.54 g/mol. Its IUPAC name is 5-[[3-fluoro-4-methoxy-5-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)phenyl]methyl]imidazolidine-2,4-dione.
| Compound Name | 5-[[3-fluoro-4-methoxy-5-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)phenyl]methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 23560016 |
| Molecular Formula | C26H31FN2O3 |
| Molecular Weight | 438.54 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | 5-[[3-fluoro-4-methoxy-5-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)phenyl]methyl]imidazolidine-2,4-dione |
| SMILES | COc1c(F)cc(CC2NC(=O)NC2=O)cc1-c1cc2c(cc1C)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C26H31FN2O3/c1-14-9-18-19(26(4,5)8-7-25(18,2)3)13-16(14)17-10-15(11-20(27)22(17)32-6)12-21-23(30)29-24(31)28-21/h9-11,13,21H,7-8,12H2,1-6H3,(H2,28,29,30,31) |
| InChIKey | QNRMTVUEOJCKCT-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.54 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|