C8H12O4 — CID 23560436
2-(methoxymethoxymethyl)cyclopentane-1,3-dione (PubChem CID 23560436) has the molecular formula C8H12O4 and a molecular weight of 172.18 g/mol. Its IUPAC name is 2-(methoxymethoxymethyl)cyclopentane-1,3-dione.
| Compound Name | 2-(methoxymethoxymethyl)cyclopentane-1,3-dione |
|---|---|
| PubChem CID | 23560436 |
| Molecular Formula | C8H12O4 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | 2-(methoxymethoxymethyl)cyclopentane-1,3-dione |
| SMILES | COCOCC1C(=O)CCC1=O |
| InChI | InChI=1S/C8H12O4/c1-11-5-12-4-6-7(9)2-3-8(6)10/h6H,2-5H2,1H3 |
| InChIKey | AEYCEVJKDFRFCT-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|