About 1,3-dioxolan-4-ylmethyl 4-(2-bicyclo[2.2.1]hept-5-enyl)butanoate
1,3-dioxolan-4-ylmethyl 4-(2-bicyclo[2.2.1]hept-5-enyl)butanoate (PubChem CID 23561043) has the molecular formula C15H22O4
and a molecular weight of 266.34 g/mol. Its IUPAC name is 1,3-dioxolan-4-ylmethyl 4-(2-bicyclo[2.2.1]hept-5-enyl)butanoate.
Molecular Properties
| Compound Name | 1,3-dioxolan-4-ylmethyl 4-(2-bicyclo[2.2.1]hept-5-enyl)butanoate |
| PubChem CID | 23561043 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 1,3-dioxolan-4-ylmethyl 4-(2-bicyclo[2.2.1]hept-5-enyl)butanoate |
| SMILES | O=C(CCCC1CC2C=CC1C2)OCC1COCO1 |
| InChI | InChI=1S/C15H22O4/c16-15(18-9-14-8-17-10-19-14)3-1-2-12-6-11-4-5-13(12)7-11/h4-5,11-14H,1-3,6-10H2 |
| InChIKey | RHIBYIRXCZUSHK-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dioxolan-4-ylmethyl 4-(2-bicyclo[2.2.1]hept-5-enyl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dioxolan-4-ylmethyl 4-(2-bicyclo[2.2.1]hept-5-enyl)butanoate?
The IUPAC name of 1,3-dioxolan-4-ylmethyl 4-(2-bicyclo[2.2.1]hept-5-enyl)butanoate (CID 23561043) is 1,3-dioxolan-4-ylmethyl 4-(2-bicyclo[2.2.1]hept-5-enyl)butanoate.
What is the SMILES notation for 1,3-dioxolan-4-ylmethyl 4-(2-bicyclo[2.2.1]hept-5-enyl)butanoate?
The canonical SMILES for 1,3-dioxolan-4-ylmethyl 4-(2-bicyclo[2.2.1]hept-5-enyl)butanoate is O=C(CCCC1CC2C=CC1C2)OCC1COCO1.
What is the InChIKey of 1,3-dioxolan-4-ylmethyl 4-(2-bicyclo[2.2.1]hept-5-enyl)butanoate?
The InChIKey is RHIBYIRXCZUSHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O4/c16-15(18-9-14-8-17-10-19-14)3-1-2-12-6-11-4-5-13(12)7-11/h4-5,11-14H,1-3,6-10H2.
What are the key properties of 1,3-dioxolan-4-ylmethyl 4-(2-bicyclo[2.2.1]hept-5-enyl)butanoate?
1,3-dioxolan-4-ylmethyl 4-(2-bicyclo[2.2.1]hept-5-enyl)butanoate has a molecular weight of 266.34 g/mol, XLogP of 2.29, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dioxolan-4-ylmethyl 4-(2-bicyclo[2.2.1]hept-5-enyl)butanoate is sourced from PubChem (CID 23561043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).