C18H24O4 — CID 23561067
1,3-dioxolan-4-ylmethyl 2-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)acetate (PubChem CID 23561067) has the molecular formula C18H24O4 and a molecular weight of 304.39 g/mol. Its IUPAC name is 1,3-dioxolan-4-ylmethyl 2-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)acetate.
| Compound Name | 1,3-dioxolan-4-ylmethyl 2-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)acetate |
|---|---|
| PubChem CID | 23561067 |
| Molecular Formula | C18H24O4 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 1,3-dioxolan-4-ylmethyl 2-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)acetate |
| SMILES | O=C(CC1CC2CC1C1C3C=CC(C3)C21)OCC1COCO1 |
| InChI | InChI=1S/C18H24O4/c19-16(21-8-14-7-20-9-22-14)6-12-4-13-5-15(12)18-11-2-1-10(3-11)17(13)18/h1-2,10-15,17-18H,3-9H2 |
| InChIKey | KJJRLXZTXSLQGN-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|