About 3-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)propyl 2-methylbutanoate
3-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)propyl 2-methylbutanoate (PubChem CID 23561574) has the molecular formula C14H21NO4
and a molecular weight of 267.32 g/mol. Its IUPAC name is 3-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)propyl 2-methylbutanoate.
Molecular Properties
| Compound Name | 3-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)propyl 2-methylbutanoate |
| PubChem CID | 23561574 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 3-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)propyl 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OCCCN1C(=O)C(C)=C(C)C1=O |
| InChI | InChI=1S/C14H21NO4/c1-5-9(2)14(18)19-8-6-7-15-12(16)10(3)11(4)13(15)17/h9H,5-8H2,1-4H3 |
| InChIKey | BUFQPKMVTWDGLQ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)propyl 2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)propyl 2-methylbutanoate?
The IUPAC name of 3-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)propyl 2-methylbutanoate (CID 23561574) is 3-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)propyl 2-methylbutanoate.
What is the SMILES notation for 3-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)propyl 2-methylbutanoate?
The canonical SMILES for 3-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)propyl 2-methylbutanoate is CCC(C)C(=O)OCCCN1C(=O)C(C)=C(C)C1=O.
What is the InChIKey of 3-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)propyl 2-methylbutanoate?
The InChIKey is BUFQPKMVTWDGLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO4/c1-5-9(2)14(18)19-8-6-7-15-12(16)10(3)11(4)13(15)17/h9H,5-8H2,1-4H3.
What are the key properties of 3-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)propyl 2-methylbutanoate?
3-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)propyl 2-methylbutanoate has a molecular weight of 267.32 g/mol, XLogP of 1.67, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)propyl 2-methylbutanoate is sourced from PubChem (CID 23561574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).