C10H12O2S — CID 23561668
2,3,5,7-tetramethylthieno[3,4-b][1,4]dioxine (PubChem CID 23561668) has the molecular formula C10H12O2S and a molecular weight of 196.27 g/mol. Its IUPAC name is 2,3,5,7-tetramethylthieno[3,4-b][1,4]dioxine.
| Compound Name | 2,3,5,7-tetramethylthieno[3,4-b][1,4]dioxine |
|---|---|
| PubChem CID | 23561668 |
| Molecular Formula | C10H12O2S |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.06 |
| IUPAC Name | 2,3,5,7-tetramethylthieno[3,4-b][1,4]dioxine |
| SMILES | CC1=C(C)Oc2c(C)sc(C)c2O1 |
| InChI | InChI=1S/C10H12O2S/c1-5-6(2)12-10-8(4)13-7(3)9(10)11-5/h1-4H3 |
| InChIKey | XTGBGWATPVJCFC-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |