About (8-methyl-8-tricyclo[5.2.1.02,6]decanyl) 2-[4-(1-butoxyethyl)-2,5-dioxooxolan-3-yl]propanoate
(8-methyl-8-tricyclo[5.2.1.02,6]decanyl) 2-[4-(1-butoxyethyl)-2,5-dioxooxolan-3-yl]propanoate (PubChem CID 23561912) has the molecular formula C24H36O6
and a molecular weight of 420.55 g/mol. Its IUPAC name is (8-methyl-8-tricyclo[5.2.1.02,6]decanyl) 2-[4-(1-butoxyethyl)-2,5-dioxooxolan-3-yl]propanoate.
Molecular Properties
| Compound Name | (8-methyl-8-tricyclo[5.2.1.02,6]decanyl) 2-[4-(1-butoxyethyl)-2,5-dioxooxolan-3-yl]propanoate |
| PubChem CID | 23561912 |
| Molecular Formula | C24H36O6 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | (8-methyl-8-tricyclo[5.2.1.02,6]decanyl) 2-[4-(1-butoxyethyl)-2,5-dioxooxolan-3-yl]propanoate |
| SMILES | CCCCOC(C)C1C(=O)OC(=O)C1C(C)C(=O)OC1(C)CC2CC1C1CCCC21 |
| InChI | InChI=1S/C24H36O6/c1-5-6-10-28-14(3)20-19(22(26)29-23(20)27)13(2)21(25)30-24(4)12-15-11-18(24)17-9-7-8-16(15)17/h13-20H,5-12H2,1-4H3 |
| InChIKey | MEPRLDIUIWWAPM-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (8-methyl-8-tricyclo[5.2.1.02,6]decanyl) 2-[4-(1-butoxyethyl)-2,5-dioxooxolan-3-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8-methyl-8-tricyclo[5.2.1.02,6]decanyl) 2-[4-(1-butoxyethyl)-2,5-dioxooxolan-3-yl]propanoate?
The IUPAC name of (8-methyl-8-tricyclo[5.2.1.02,6]decanyl) 2-[4-(1-butoxyethyl)-2,5-dioxooxolan-3-yl]propanoate (CID 23561912) is (8-methyl-8-tricyclo[5.2.1.02,6]decanyl) 2-[4-(1-butoxyethyl)-2,5-dioxooxolan-3-yl]propanoate.
What is the SMILES notation for (8-methyl-8-tricyclo[5.2.1.02,6]decanyl) 2-[4-(1-butoxyethyl)-2,5-dioxooxolan-3-yl]propanoate?
The canonical SMILES for (8-methyl-8-tricyclo[5.2.1.02,6]decanyl) 2-[4-(1-butoxyethyl)-2,5-dioxooxolan-3-yl]propanoate is CCCCOC(C)C1C(=O)OC(=O)C1C(C)C(=O)OC1(C)CC2CC1C1CCCC21.
What is the InChIKey of (8-methyl-8-tricyclo[5.2.1.02,6]decanyl) 2-[4-(1-butoxyethyl)-2,5-dioxooxolan-3-yl]propanoate?
The InChIKey is MEPRLDIUIWWAPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H36O6/c1-5-6-10-28-14(3)20-19(22(26)29-23(20)27)13(2)21(25)30-24(4)12-15-11-18(24)17-9-7-8-16(15)17/h13-20H,5-12H2,1-4H3.
What are the key properties of (8-methyl-8-tricyclo[5.2.1.02,6]decanyl) 2-[4-(1-butoxyethyl)-2,5-dioxooxolan-3-yl]propanoate?
(8-methyl-8-tricyclo[5.2.1.02,6]decanyl) 2-[4-(1-butoxyethyl)-2,5-dioxooxolan-3-yl]propanoate has a molecular weight of 420.55 g/mol, XLogP of 3.90, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (8-methyl-8-tricyclo[5.2.1.02,6]decanyl) 2-[4-(1-butoxyethyl)-2,5-dioxooxolan-3-yl]propanoate is sourced from PubChem (CID 23561912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).