C24H15ClF4N4O3 — CID 23562056
N-[5-chloro-2-hydroxy-4-[(2,3,4,5-tetrafluorobenzoyl)amino]phenyl]-5-methyl-1-phenylpyrazole-3-carboxamide (PubChem CID 23562056) has the molecular formula C24H15ClF4N4O3 and a molecular weight of 518.85 g/mol. Its IUPAC name is N-[5-chloro-2-hydroxy-4-[(2,3,4,5-tetrafluorobenzoyl)amino]phenyl]-5-methyl-1-phenylpyrazole-3-carboxamide.
| Compound Name | N-[5-chloro-2-hydroxy-4-[(2,3,4,5-tetrafluorobenzoyl)amino]phenyl]-5-methyl-1-phenylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 23562056 |
| Molecular Formula | C24H15ClF4N4O3 |
| Molecular Weight | 518.85 g/mol |
| Exact Mass | 518.08 |
| IUPAC Name | N-[5-chloro-2-hydroxy-4-[(2,3,4,5-tetrafluorobenzoyl)amino]phenyl]-5-methyl-1-phenylpyrazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2cc(Cl)c(NC(=O)c3cc(F)c(F)c(F)c3F)cc2O)nn1-c1ccccc1 |
| InChI | InChI=1S/C24H15ClF4N4O3/c1-11-7-18(32-33(11)12-5-3-2-4-6-12)24(36)31-17-9-14(25)16(10-19(17)34)30-23(35)13-8-15(26)21(28)22(29)20(13)27/h2-10,34H,1H3,(H,30,35)(H,31,36) |
| InChIKey | KJFHTEMDJKUXGT-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.85 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|