About 1-propan-2-yltriazolo[4,5-d]pyrimidin-7-amine
1-propan-2-yltriazolo[4,5-d]pyrimidin-7-amine (PubChem CID 23562746) has the molecular formula C7H10N6
and a molecular weight of 178.20 g/mol. Its IUPAC name is 1-propan-2-yltriazolo[4,5-d]pyrimidin-7-amine.
Molecular Properties
| Compound Name | 1-propan-2-yltriazolo[4,5-d]pyrimidin-7-amine |
| PubChem CID | 23562746 |
| Molecular Formula | C7H10N6 |
| Molecular Weight | 178.20 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 1-propan-2-yltriazolo[4,5-d]pyrimidin-7-amine |
| SMILES | CC(C)n1nnc2ncnc(N)c21 |
| InChI | InChI=1S/C7H10N6/c1-4(2)13-5-6(8)9-3-10-7(5)11-12-13/h3-4H,1-2H3,(H2,8,9,10) |
| InChIKey | TVEJSXGEQNESQR-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.20 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-propan-2-yltriazolo[4,5-d]pyrimidin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propan-2-yltriazolo[4,5-d]pyrimidin-7-amine?
The IUPAC name of 1-propan-2-yltriazolo[4,5-d]pyrimidin-7-amine (CID 23562746) is 1-propan-2-yltriazolo[4,5-d]pyrimidin-7-amine.
What is the SMILES notation for 1-propan-2-yltriazolo[4,5-d]pyrimidin-7-amine?
The canonical SMILES for 1-propan-2-yltriazolo[4,5-d]pyrimidin-7-amine is CC(C)n1nnc2ncnc(N)c21.
What is the InChIKey of 1-propan-2-yltriazolo[4,5-d]pyrimidin-7-amine?
The InChIKey is TVEJSXGEQNESQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N6/c1-4(2)13-5-6(8)9-3-10-7(5)11-12-13/h3-4H,1-2H3,(H2,8,9,10).
What are the key properties of 1-propan-2-yltriazolo[4,5-d]pyrimidin-7-amine?
1-propan-2-yltriazolo[4,5-d]pyrimidin-7-amine has a molecular weight of 178.20 g/mol, XLogP of 0.38, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propan-2-yltriazolo[4,5-d]pyrimidin-7-amine is sourced from PubChem (CID 23562746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).