C21H28N2O — CID 23562795
3-[(3R,4S)-3,4-dimethyl-1-(3-pyridin-4-ylpropyl)piperidin-2-yl]phenol (PubChem CID 23562795) has the molecular formula C21H28N2O and a molecular weight of 324.47 g/mol. Its IUPAC name is 3-[(3R,4S)-3,4-dimethyl-1-(3-pyridin-4-ylpropyl)piperidin-2-yl]phenol.
| Compound Name | 3-[(3R,4S)-3,4-dimethyl-1-(3-pyridin-4-ylpropyl)piperidin-2-yl]phenol |
|---|---|
| PubChem CID | 23562795 |
| Molecular Formula | C21H28N2O |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | 3-[(3R,4S)-3,4-dimethyl-1-(3-pyridin-4-ylpropyl)piperidin-2-yl]phenol |
| SMILES | C[C@H]1CCN(CCCc2ccncc2)C(c2cccc(O)c2)[C@@H]1C |
| InChI | InChI=1S/C21H28N2O/c1-16-10-14-23(13-4-5-18-8-11-22-12-9-18)21(17(16)2)19-6-3-7-20(24)15-19/h3,6-9,11-12,15-17,21,24H,4-5,10,13-14H2,1-2H3/t16-,17+,21?/m0/s1 |
| InChIKey | ZLFUZCRLTQVIIY-NXRUOVBSSA-N |
| XLogP | 4.44 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |