About N-[2-[(1S,3S)-1-(aminomethyl)-3-methylcyclopentyl]ethyl]methanesulfonamide
N-[2-[(1S,3S)-1-(aminomethyl)-3-methylcyclopentyl]ethyl]methanesulfonamide (PubChem CID 23563038) has the molecular formula C10H22N2O2S
and a molecular weight of 234.36 g/mol. Its IUPAC name is N-[2-[(1S,3S)-1-(aminomethyl)-3-methylcyclopentyl]ethyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[2-[(1S,3S)-1-(aminomethyl)-3-methylcyclopentyl]ethyl]methanesulfonamide |
| PubChem CID | 23563038 |
| Molecular Formula | C10H22N2O2S |
| Molecular Weight | 234.36 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | N-[2-[(1S,3S)-1-(aminomethyl)-3-methylcyclopentyl]ethyl]methanesulfonamide |
| SMILES | C[C@H]1CC[C@@](CN)(CCNS(C)(=O)=O)C1 |
| InChI | InChI=1S/C10H22N2O2S/c1-9-3-4-10(7-9,8-11)5-6-12-15(2,13)14/h9,12H,3-8,11H2,1-2H3/t9-,10+/m0/s1 |
| InChIKey | BHSGPLBWLQMWGF-VHSXEESVSA-N |
| XLogP | 0.69 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.36 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[2-[(1S,3S)-1-(aminomethyl)-3-methylcyclopentyl]ethyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[(1S,3S)-1-(aminomethyl)-3-methylcyclopentyl]ethyl]methanesulfonamide?
The IUPAC name of N-[2-[(1S,3S)-1-(aminomethyl)-3-methylcyclopentyl]ethyl]methanesulfonamide (CID 23563038) is N-[2-[(1S,3S)-1-(aminomethyl)-3-methylcyclopentyl]ethyl]methanesulfonamide.
What is the SMILES notation for N-[2-[(1S,3S)-1-(aminomethyl)-3-methylcyclopentyl]ethyl]methanesulfonamide?
The canonical SMILES for N-[2-[(1S,3S)-1-(aminomethyl)-3-methylcyclopentyl]ethyl]methanesulfonamide is C[C@H]1CC[C@@](CN)(CCNS(C)(=O)=O)C1.
What is the InChIKey of N-[2-[(1S,3S)-1-(aminomethyl)-3-methylcyclopentyl]ethyl]methanesulfonamide?
The InChIKey is BHSGPLBWLQMWGF-VHSXEESVSA-N. The full InChI is InChI=1S/C10H22N2O2S/c1-9-3-4-10(7-9,8-11)5-6-12-15(2,13)14/h9,12H,3-8,11H2,1-2H3/t9-,10+/m0/s1.
What are the key properties of N-[2-[(1S,3S)-1-(aminomethyl)-3-methylcyclopentyl]ethyl]methanesulfonamide?
N-[2-[(1S,3S)-1-(aminomethyl)-3-methylcyclopentyl]ethyl]methanesulfonamide has a molecular weight of 234.36 g/mol, XLogP of 0.69, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[(1S,3S)-1-(aminomethyl)-3-methylcyclopentyl]ethyl]methanesulfonamide is sourced from PubChem (CID 23563038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).