About [(1R)-1-(aminomethyl)-3,3-dimethylcyclopentyl]methanesulfonamide
[(1R)-1-(aminomethyl)-3,3-dimethylcyclopentyl]methanesulfonamide (PubChem CID 23563056) has the molecular formula C9H20N2O2S
and a molecular weight of 220.34 g/mol. Its IUPAC name is [(1R)-1-(aminomethyl)-3,3-dimethylcyclopentyl]methanesulfonamide.
Molecular Properties
| Compound Name | [(1R)-1-(aminomethyl)-3,3-dimethylcyclopentyl]methanesulfonamide |
| PubChem CID | 23563056 |
| Molecular Formula | C9H20N2O2S |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | [(1R)-1-(aminomethyl)-3,3-dimethylcyclopentyl]methanesulfonamide |
| SMILES | CC1(C)CC[C@@](CN)(CS(N)(=O)=O)C1 |
| InChI | InChI=1S/C9H20N2O2S/c1-8(2)3-4-9(5-8,6-10)7-14(11,12)13/h3-7,10H2,1-2H3,(H2,11,12,13)/t9-/m1/s1 |
| InChIKey | XMOREOBNYOKDMM-SECBINFHSA-N |
| XLogP | 0.43 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(1R)-1-(aminomethyl)-3,3-dimethylcyclopentyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-1-(aminomethyl)-3,3-dimethylcyclopentyl]methanesulfonamide?
The IUPAC name of [(1R)-1-(aminomethyl)-3,3-dimethylcyclopentyl]methanesulfonamide (CID 23563056) is [(1R)-1-(aminomethyl)-3,3-dimethylcyclopentyl]methanesulfonamide.
What is the SMILES notation for [(1R)-1-(aminomethyl)-3,3-dimethylcyclopentyl]methanesulfonamide?
The canonical SMILES for [(1R)-1-(aminomethyl)-3,3-dimethylcyclopentyl]methanesulfonamide is CC1(C)CC[C@@](CN)(CS(N)(=O)=O)C1.
What is the InChIKey of [(1R)-1-(aminomethyl)-3,3-dimethylcyclopentyl]methanesulfonamide?
The InChIKey is XMOREOBNYOKDMM-SECBINFHSA-N. The full InChI is InChI=1S/C9H20N2O2S/c1-8(2)3-4-9(5-8,6-10)7-14(11,12)13/h3-7,10H2,1-2H3,(H2,11,12,13)/t9-/m1/s1.
What are the key properties of [(1R)-1-(aminomethyl)-3,3-dimethylcyclopentyl]methanesulfonamide?
[(1R)-1-(aminomethyl)-3,3-dimethylcyclopentyl]methanesulfonamide has a molecular weight of 220.34 g/mol, XLogP of 0.43, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-1-(aminomethyl)-3,3-dimethylcyclopentyl]methanesulfonamide is sourced from PubChem (CID 23563056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).