About 2-fluoropropanamide
2-fluoropropanamide (PubChem CID 23563332) has the molecular formula C3H6FNO
and a molecular weight of 91.08 g/mol. Its IUPAC name is 2-fluoropropanamide.
Molecular Properties
| Compound Name | 2-fluoropropanamide |
| PubChem CID | 23563332 |
| Molecular Formula | C3H6FNO |
| Molecular Weight | 91.08 g/mol |
| Exact Mass | 91.04 |
| IUPAC Name | 2-fluoropropanamide |
| SMILES | CC(F)C(N)=O |
| InChI | InChI=1S/C3H6FNO/c1-2(4)3(5)6/h2H,1H3,(H2,5,6) |
| InChIKey | DFEYCTOVBPSNBP-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 91.08 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-fluoropropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoropropanamide?
The IUPAC name of 2-fluoropropanamide (CID 23563332) is 2-fluoropropanamide.
What is the SMILES notation for 2-fluoropropanamide?
The canonical SMILES for 2-fluoropropanamide is CC(F)C(N)=O.
What is the InChIKey of 2-fluoropropanamide?
The InChIKey is DFEYCTOVBPSNBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6FNO/c1-2(4)3(5)6/h2H,1H3,(H2,5,6).
What are the key properties of 2-fluoropropanamide?
2-fluoropropanamide has a molecular weight of 91.08 g/mol, XLogP of -0.17, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoropropanamide is sourced from PubChem (CID 23563332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).