C14H21NO3 — CID 23563495
propyl N-[2-(4-methoxy-3-methylphenyl)ethyl]carbamate (PubChem CID 23563495) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is propyl N-[2-(4-methoxy-3-methylphenyl)ethyl]carbamate.
| Compound Name | propyl N-[2-(4-methoxy-3-methylphenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 23563495 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | propyl N-[2-(4-methoxy-3-methylphenyl)ethyl]carbamate |
| SMILES | CCCOC(=O)NCCc1ccc(OC)c(C)c1 |
| InChI | InChI=1S/C14H21NO3/c1-4-9-18-14(16)15-8-7-12-5-6-13(17-3)11(2)10-12/h5-6,10H,4,7-9H2,1-3H3,(H,15,16) |
| InChIKey | RZGNNFVWPYPIAR-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |