C32H47NO2Si — CID 23563603
N-[(1S)-1-[(1R,2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-methylidenecyclopentyl]-3-ethylpentyl]acetamide (PubChem CID 23563603) has the molecular formula C32H47NO2Si and a molecular weight of 505.82 g/mol. Its IUPAC name is N-[(1S)-1-[(1R,2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-methylidenecyclopentyl]-3-ethylpentyl]acetamide.
| Compound Name | N-[(1S)-1-[(1R,2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-methylidenecyclopentyl]-3-ethylpentyl]acetamide |
|---|---|
| PubChem CID | 23563603 |
| Molecular Formula | C32H47NO2Si |
| Molecular Weight | 505.82 g/mol |
| Exact Mass | 505.34 |
| IUPAC Name | N-[(1S)-1-[(1R,2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-methylidenecyclopentyl]-3-ethylpentyl]acetamide |
| SMILES | C=C1C[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H]([C@H](CC(CC)CC)NC(C)=O)C1 |
| InChI | InChI=1S/C32H47NO2Si/c1-8-26(9-2)22-31(33-25(4)34)30-21-24(3)20-27(30)23-35-36(32(5,6)7,28-16-12-10-13-17-28)29-18-14-11-15-19-29/h10-19,26-27,30-31H,3,8-9,20-23H2,1-2,4-7H3,(H,33,34)/t27-,30+,31-/m0/s1 |
| InChIKey | AIMQYDMKTZYCGX-XTHXZNCLSA-N |
| XLogP | 6.48 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.82 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|