C32H49NO3Si — CID 23563608
N-[(1S)-1-[(1R,2R,4R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(hydroxymethyl)cyclopentyl]-3-ethylpentyl]acetamide (PubChem CID 23563608) has the molecular formula C32H49NO3Si and a molecular weight of 523.83 g/mol. Its IUPAC name is N-[(1S)-1-[(1R,2R,4R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(hydroxymethyl)cyclopentyl]-3-ethylpentyl]acetamide.
| Compound Name | N-[(1S)-1-[(1R,2R,4R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(hydroxymethyl)cyclopentyl]-3-ethylpentyl]acetamide |
|---|---|
| PubChem CID | 23563608 |
| Molecular Formula | C32H49NO3Si |
| Molecular Weight | 523.83 g/mol |
| Exact Mass | 523.35 |
| IUPAC Name | N-[(1S)-1-[(1R,2R,4R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(hydroxymethyl)cyclopentyl]-3-ethylpentyl]acetamide |
| SMILES | CCC(CC)C[C@H](NC(C)=O)[C@@H]1C[C@@H](CO)C[C@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C32H49NO3Si/c1-7-25(8-2)21-31(33-24(3)35)30-20-26(22-34)19-27(30)23-36-37(32(4,5)6,28-15-11-9-12-16-28)29-17-13-10-14-18-29/h9-18,25-27,30-31,34H,7-8,19-23H2,1-6H3,(H,33,35)/t26-,27-,30+,31-/m0/s1 |
| InChIKey | KFYIYZHVLAEXMF-FOHQDORMSA-N |
| XLogP | 5.53 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.83 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|