C28H25NO5S — CID 2356362
N-benzyl-N-[(2S)-3-dibenzofuran-2-yloxy-2-hydroxypropyl]benzenesulfonamide (PubChem CID 2356362) has the molecular formula C28H25NO5S and a molecular weight of 487.58 g/mol. Its IUPAC name is N-benzyl-N-[(2S)-3-dibenzofuran-2-yloxy-2-hydroxypropyl]benzenesulfonamide.
| Compound Name | N-benzyl-N-[(2S)-3-dibenzofuran-2-yloxy-2-hydroxypropyl]benzenesulfonamide |
|---|---|
| PubChem CID | 2356362 |
| Molecular Formula | C28H25NO5S |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | N-benzyl-N-[(2S)-3-dibenzofuran-2-yloxy-2-hydroxypropyl]benzenesulfonamide |
| SMILES | O=S(=O)(c1ccccc1)N(Cc1ccccc1)C[C@H](O)COc1ccc2oc3ccccc3c2c1 |
| InChI | InChI=1S/C28H25NO5S/c30-22(20-33-23-15-16-28-26(17-23)25-13-7-8-14-27(25)34-28)19-29(18-21-9-3-1-4-10-21)35(31,32)24-11-5-2-6-12-24/h1-17,22,30H,18-20H2/t22-/m0/s1 |
| InChIKey | IUVQLOMKILLUAD-QFIPXVFZSA-N |
| XLogP | 5.22 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |