C32H47NO4Si — CID 23563624
(1R,3R,4R)-3-[(1S)-1-acetamido-3-ethylpentyl]-4-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopentane-1-carboxylic acid (PubChem CID 23563624) has the molecular formula C32H47NO4Si and a molecular weight of 537.82 g/mol. Its IUPAC name is (1R,3R,4R)-3-[(1S)-1-acetamido-3-ethylpentyl]-4-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopentane-1-carboxylic acid.
| Compound Name | (1R,3R,4R)-3-[(1S)-1-acetamido-3-ethylpentyl]-4-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 23563624 |
| Molecular Formula | C32H47NO4Si |
| Molecular Weight | 537.82 g/mol |
| Exact Mass | 537.33 |
| IUPAC Name | (1R,3R,4R)-3-[(1S)-1-acetamido-3-ethylpentyl]-4-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopentane-1-carboxylic acid |
| SMILES | CCC(CC)C[C@H](NC(C)=O)[C@@H]1C[C@@H](C(=O)O)C[C@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C32H47NO4Si/c1-7-24(8-2)19-30(33-23(3)34)29-21-25(31(35)36)20-26(29)22-37-38(32(4,5)6,27-15-11-9-12-16-27)28-17-13-10-14-18-28/h9-18,24-26,29-30H,7-8,19-22H2,1-6H3,(H,33,34)(H,35,36)/t25-,26-,29+,30-/m0/s1 |
| InChIKey | MWMSDMJIXGMYOV-QDXOBKQDSA-N |
| XLogP | 5.62 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.82 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|